C17H15BrN2O3 — CID 164609818
4-[(6-bromo-2-oxo-3,4-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide (PubChem CID 164609818) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is 4-[(6-bromo-2-oxo-3,4-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide.
| Compound Name | 4-[(6-bromo-2-oxo-3,4-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164609818 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 4-[(6-bromo-2-oxo-3,4-dihydroquinolin-1-yl)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)CCc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C17H15BrN2O3/c18-14-6-7-15-13(9-14)5-8-16(21)20(15)10-11-1-3-12(4-2-11)17(22)19-23/h1-4,6-7,9,23H,5,8,10H2,(H,19,22) |
| InChIKey | JPJFUWDPIOTPKO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|