C18H14Br2N2O3 — CID 39166499
N-(2,5-dibromophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 39166499) has the molecular formula C18H14Br2N2O3 and a molecular weight of 466.13 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-(2,5-dibromophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 39166499 |
| Molecular Formula | C18H14Br2N2O3 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | N-(2,5-dibromophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1cc(Br)ccc1Br)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C18H14Br2N2O3/c19-13-5-6-14(20)15(9-13)21-18(25)12-3-1-11(2-4-12)10-22-16(23)7-8-17(22)24/h1-6,9H,7-8,10H2,(H,21,25) |
| InChIKey | NZDAYCOJDPUZLG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|