C18H14F2N2O3 — CID 17498612
N-(3,4-difluorophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 17498612) has the molecular formula C18H14F2N2O3 and a molecular weight of 344.32 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-(3,4-difluorophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 17498612 |
| Molecular Formula | C18H14F2N2O3 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C18H14F2N2O3/c19-14-6-5-13(9-15(14)20)21-18(25)12-3-1-11(2-4-12)10-22-16(23)7-8-17(22)24/h1-6,9H,7-8,10H2,(H,21,25) |
| InChIKey | IOESUFLDVSPGED-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|