C22H17Cl2N3O2 — CID 60597421
6-chloro-N-[1-[(4-chlorophenyl)methyl]-2-oxo-3,4-dihydroquinolin-6-yl]pyridine-3-carboxamide (PubChem CID 60597421) has the molecular formula C22H17Cl2N3O2 and a molecular weight of 426.30 g/mol. Its IUPAC name is 6-chloro-N-[1-[(4-chlorophenyl)methyl]-2-oxo-3,4-dihydroquinolin-6-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[1-[(4-chlorophenyl)methyl]-2-oxo-3,4-dihydroquinolin-6-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60597421 |
| Molecular Formula | C22H17Cl2N3O2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 6-chloro-N-[1-[(4-chlorophenyl)methyl]-2-oxo-3,4-dihydroquinolin-6-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC(=O)N2Cc1ccc(Cl)cc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C22H17Cl2N3O2/c23-17-5-1-14(2-6-17)13-27-19-8-7-18(11-15(19)4-10-21(27)28)26-22(29)16-3-9-20(24)25-12-16/h1-3,5-9,11-12H,4,10,13H2,(H,26,29) |
| InChIKey | VVURJRQENBDHKK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|