C29H32N2O5 — CID 16926904
N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3,4,5-triethoxybenzamide (PubChem CID 16926904) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 16926904 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3c(c2)CCC(=O)N3Cc2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C29H32N2O5/c1-4-34-25-17-22(18-26(35-5-2)28(25)36-6-3)29(33)30-23-13-14-24-21(16-23)12-15-27(32)31(24)19-20-10-8-7-9-11-20/h7-11,13-14,16-18H,4-6,12,15,19H2,1-3H3,(H,30,33) |
| InChIKey | JCCSJFRWQSNFJI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |