C25H25N3O3 — CID 30376599
1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-ethoxyphenyl)urea (PubChem CID 30376599) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 30376599 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-ethoxyphenyl)urea |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc2c(c1)CCC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H25N3O3/c1-2-31-23-11-7-6-10-21(23)27-25(30)26-20-13-14-22-19(16-20)12-15-24(29)28(22)17-18-8-4-3-5-9-18/h3-11,13-14,16H,2,12,15,17H2,1H3,(H2,26,27,30) |
| InChIKey | HNBKONXNVKEDHX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |