C23H19Cl2N3O2 — CID 30376488
1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3,4-dichlorophenyl)urea (PubChem CID 30376488) has the molecular formula C23H19Cl2N3O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is 1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 30376488 |
| Molecular Formula | C23H19Cl2N3O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 1-(1-benzyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc2c(c1)CCC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H19Cl2N3O2/c24-19-9-7-18(13-20(19)25)27-23(30)26-17-8-10-21-16(12-17)6-11-22(29)28(21)14-15-4-2-1-3-5-15/h1-5,7-10,12-13H,6,11,14H2,(H2,26,27,30) |
| InChIKey | AATBHEUCDAKTOS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |