C21H20ClN3O4 — CID 38956339
4-chloro-3-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-N,N-dimethylbenzamide (PubChem CID 38956339) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is 4-chloro-3-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-3-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 38956339 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-chloro-3-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)c(NC(=O)c2ccc(CN3C(=O)CCC3=O)cc2)c1 |
| InChI | InChI=1S/C21H20ClN3O4/c1-24(2)21(29)15-7-8-16(22)17(11-15)23-20(28)14-5-3-13(4-6-14)12-25-18(26)9-10-19(25)27/h3-8,11H,9-10,12H2,1-2H3,(H,23,28) |
| InChIKey | OQQGKZLWRYRUAL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|