C21H20Cl2N2O3 — CID 49149193
N-[2-(3,4-dichlorophenyl)propan-2-yl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 49149193) has the molecular formula C21H20Cl2N2O3 and a molecular weight of 419.31 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)propan-2-yl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)propan-2-yl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 49149193 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)propan-2-yl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | CC(C)(NC(=O)c1ccc(CN2C(=O)CCC2=O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H20Cl2N2O3/c1-21(2,15-7-8-16(22)17(23)11-15)24-20(28)14-5-3-13(4-6-14)12-25-18(26)9-10-19(25)27/h3-8,11H,9-10,12H2,1-2H3,(H,24,28) |
| InChIKey | BANOQNGLFKFRED-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|