C20H17Cl2N3O4S — CID 24641200
N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzohydrazide (PubChem CID 24641200) has the molecular formula C20H17Cl2N3O4S and a molecular weight of 466.35 g/mol. Its IUPAC name is N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzohydrazide.
| Compound Name | N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 24641200 |
| Molecular Formula | C20H17Cl2N3O4S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzohydrazide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)NNC(=O)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O4S/c21-14-5-6-15(22)16(9-14)30-11-17(26)23-24-20(29)13-3-1-12(2-4-13)10-25-18(27)7-8-19(25)28/h1-6,9H,7-8,10-11H2,(H,23,26)(H,24,29) |
| InChIKey | RFVMVMFIRDHNPG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|