C14H9Cl4N3O2S — CID 24641131
5,6-dichloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]pyridine-3-carbohydrazide (PubChem CID 24641131) has the molecular formula C14H9Cl4N3O2S and a molecular weight of 425.12 g/mol. Its IUPAC name is 5,6-dichloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]pyridine-3-carbohydrazide.
| Compound Name | 5,6-dichloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24641131 |
| Molecular Formula | C14H9Cl4N3O2S |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.92 |
| IUPAC Name | 5,6-dichloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]pyridine-3-carbohydrazide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)NNC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl4N3O2S/c15-8-1-2-9(16)11(4-8)24-6-12(22)20-21-14(23)7-3-10(17)13(18)19-5-7/h1-5H,6H2,(H,20,22)(H,21,23) |
| InChIKey | LYRXBROUOLEXAE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|