C23H20N4O4 — CID 48666981
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)benzamide (PubChem CID 48666981) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 48666981 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)benzamide |
| SMILES | Cc1cc(Oc2ncccn2)ccc1NC(=O)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-15-13-18(31-23-24-11-2-12-25-23)7-8-19(15)26-22(30)17-5-3-16(4-6-17)14-27-20(28)9-10-21(27)29/h2-8,11-13H,9-10,14H2,1H3,(H,26,30) |
| InChIKey | YJBZJBXAHMSENS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|