C17H14N4O3S — CID 71934170
2-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)thiophene-2,5-dicarboxamide (PubChem CID 71934170) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 71934170 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-N-(2-methyl-4-pyrimidin-2-yloxyphenyl)thiophene-2,5-dicarboxamide |
| SMILES | Cc1cc(Oc2ncccn2)ccc1NC(=O)c1ccc(C(N)=O)s1 |
| InChI | InChI=1S/C17H14N4O3S/c1-10-9-11(24-17-19-7-2-8-20-17)3-4-12(10)21-16(23)14-6-5-13(25-14)15(18)22/h2-9H,1H3,(H2,18,22)(H,21,23) |
| InChIKey | IIDQJRKAJBFKJQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |