C17H13BrFN3O3 — CID 60593281
N-(4-bromo-2-fluorophenyl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 60593281) has the molecular formula C17H13BrFN3O3 and a molecular weight of 406.21 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 60593281 |
| Molecular Formula | C17H13BrFN3O3 |
| Molecular Weight | 406.21 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C17H13BrFN3O3/c18-12-5-6-14(13(19)7-12)21-16(24)11-3-1-10(2-4-11)9-22-15(23)8-20-17(22)25/h1-7H,8-9H2,(H,20,25)(H,21,24) |
| InChIKey | PFIOXFVMCIQSEP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|