C19H13F6N3O3 — CID 34199236
N-[3,5-bis(trifluoromethyl)phenyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 34199236) has the molecular formula C19H13F6N3O3 and a molecular weight of 445.32 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 34199236 |
| Molecular Formula | C19H13F6N3O3 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C19H13F6N3O3/c20-18(21,22)12-5-13(19(23,24)25)7-14(6-12)27-16(30)11-3-1-10(2-4-11)9-28-15(29)8-26-17(28)31/h1-7H,8-9H2,(H,26,31)(H,27,30) |
| InChIKey | DFPCILNLIXCLEY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|