C25H21N3O5 — CID 33076527
[4-(phenylcarbamoyl)phenyl]methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 33076527) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is [4-(phenylcarbamoyl)phenyl]methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [4-(phenylcarbamoyl)phenyl]methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 33076527 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [4-(phenylcarbamoyl)phenyl]methyl 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(Nc1ccccc1)c1ccc(COC(=O)c2cccc(CN3C(=O)CNC3=O)c2)cc1 |
| InChI | InChI=1S/C25H21N3O5/c29-22-14-26-25(32)28(22)15-18-5-4-6-20(13-18)24(31)33-16-17-9-11-19(12-10-17)23(30)27-21-7-2-1-3-8-21/h1-13H,14-16H2,(H,26,32)(H,27,30) |
| InChIKey | AIFCQLMATHODSF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|