C16H19N3O3 — CID 33381394
N-(cyclobutylmethyl)-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 33381394) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-(cyclobutylmethyl)-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 33381394 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(cyclobutylmethyl)-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | O=C(NCC1CCC1)c1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C16H19N3O3/c20-14-9-18-16(22)19(14)10-12-5-2-6-13(7-12)15(21)17-8-11-3-1-4-11/h2,5-7,11H,1,3-4,8-10H2,(H,17,21)(H,18,22) |
| InChIKey | RVGPYULNMLLGQD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|