C20H20N4O5S — CID 55617109
N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 55617109) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 55617109 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C20H20N4O5S/c25-18-12-21-20(27)23(18)13-14-3-1-4-16(11-14)22-19(26)15-5-7-17(8-6-15)24-9-2-10-30(24,28)29/h1,3-8,11H,2,9-10,12-13H2,(H,21,27)(H,22,26) |
| InChIKey | ZGPRCNKGBUXKDO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|