C23H21N5O4S — CID 55762796
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]benzamide (PubChem CID 55762796) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]benzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55762796 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(Cn2nc3ccccn3c2=O)c1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C23H21N5O4S/c29-22(18-7-4-9-20(15-18)28-12-5-13-33(28,31)32)24-19-8-3-6-17(14-19)16-27-23(30)26-11-2-1-10-21(26)25-27/h1-4,6-11,14-15H,5,12-13,16H2,(H,24,29) |
| InChIKey | YMBQBDOJSLVVKL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |