C19H13Cl2N5O2 — CID 55763009
5,6-dichloro-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]pyridine-3-carboxamide (PubChem CID 55763009) has the molecular formula C19H13Cl2N5O2 and a molecular weight of 414.25 g/mol. Its IUPAC name is 5,6-dichloro-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55763009 |
| Molecular Formula | C19H13Cl2N5O2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 5,6-dichloro-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cn2nc3ccccn3c2=O)c1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl2N5O2/c20-15-9-13(10-22-17(15)21)18(27)23-14-5-3-4-12(8-14)11-26-19(28)25-7-2-1-6-16(25)24-26/h1-10H,11H2,(H,23,27) |
| InChIKey | OPDMALPPKQFGJN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|