C18H17Cl2N3O2 — CID 49359891
5,6-dichloro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]pyridine-3-carboxamide (PubChem CID 49359891) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 5,6-dichloro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 49359891 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 5,6-dichloro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(CN2CCCCC2=O)c1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c19-15-9-13(10-21-17(15)20)18(25)22-14-5-3-4-12(8-14)11-23-7-2-1-6-16(23)24/h3-5,8-10H,1-2,6-7,11H2,(H,22,25) |
| InChIKey | ZZQQKKSHOROBIK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|