C19H20N4O4 — CID 49412629
4-amino-3-nitro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]benzamide (PubChem CID 49412629) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-amino-3-nitro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 4-amino-3-nitro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 49412629 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-amino-3-nitro-N-[3-[(2-oxopiperidin-1-yl)methyl]phenyl]benzamide |
| SMILES | Nc1ccc(C(=O)Nc2cccc(CN3CCCCC3=O)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O4/c20-16-8-7-14(11-17(16)23(26)27)19(25)21-15-5-3-4-13(10-15)12-22-9-2-1-6-18(22)24/h3-5,7-8,10-11H,1-2,6,9,12,20H2,(H,21,25) |
| InChIKey | BDDNAGCRPTVVCT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|