C23H20N4O2 — CID 98864202
(E)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-phenylbut-2-enamide (PubChem CID 98864202) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is (E)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-phenylbut-2-enamide.
| Compound Name | (E)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 98864202 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (E)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]-3-phenylbut-2-enamide |
| SMILES | C/C(=C\C(=O)Nc1cccc(Cn2nc3ccccn3c2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C23H20N4O2/c1-17(19-9-3-2-4-10-19)14-22(28)24-20-11-7-8-18(15-20)16-27-23(29)26-13-6-5-12-21(26)25-27/h2-15H,16H2,1H3,(H,24,28)/b17-14+ |
| InChIKey | QYAYBMJCLNBPPU-SAPNQHFASA-N |
| XLogP | 3.59 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|