C23H26N4O2 — CID 94825100
cis-(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 94825100) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is cis-(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94825100 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | cis-(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[3-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)=C[C@H]1[C@H](C(=O)Nc2cccc(Cn3nc4ccccn4c3=O)c2)C1(C)C |
| InChI | InChI=1S/C23H26N4O2/c1-15(2)12-18-20(23(18,3)4)21(28)24-17-9-7-8-16(13-17)14-27-22(29)26-11-6-5-10-19(26)25-27/h5-13,18,20H,14H2,1-4H3,(H,24,28)/t18-,20+/m0/s1 |
| InChIKey | XCWCMOFNDOWIHB-AZUAARDMSA-N |
| XLogP | 3.72 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|