C23H22N2O4S — CID 112824130
N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-4-(phenoxymethyl)benzamide (PubChem CID 112824130) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-4-(phenoxymethyl)benzamide.
| Compound Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 112824130 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-4-(phenoxymethyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCCS2(=O)=O)c1)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c26-23(19-12-10-18(11-13-19)17-29-22-8-2-1-3-9-22)24-20-6-4-7-21(16-20)25-14-5-15-30(25,27)28/h1-4,6-13,16H,5,14-15,17H2,(H,24,26) |
| InChIKey | ZBBACLDFRPYQOK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |