C21H26N2O3S — CID 112505496
4-tert-butyl-N-[3-(1,1-dioxothiazinan-2-yl)phenyl]benzamide (PubChem CID 112505496) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(1,1-dioxothiazinan-2-yl)phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-(1,1-dioxothiazinan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 112505496 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-tert-butyl-N-[3-(1,1-dioxothiazinan-2-yl)phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(N3CCCCS3(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-21(2,3)17-11-9-16(10-12-17)20(24)22-18-7-6-8-19(15-18)23-13-4-5-14-27(23,25)26/h6-12,15H,4-5,13-14H2,1-3H3,(H,22,24) |
| InChIKey | WIQSFEJMCQJJEO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |