C23H30N2O3S — CID 132664679
N-[1-(4-tert-butylphenyl)ethyl]-3-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 132664679) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-3-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-3-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 132664679 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-3-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | CC(NC(=O)c1cccc(N2CCCCS2(=O)=O)c1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-17(18-10-12-20(13-11-18)23(2,3)4)24-22(26)19-8-7-9-21(16-19)25-14-5-6-15-29(25,27)28/h7-13,16-17H,5-6,14-15H2,1-4H3,(H,24,26) |
| InChIKey | RMMZUMVNDINZPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |