C25H25N3O4S — CID 55693559
N-[1-(3-benzamidophenyl)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 55693559) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[1-(3-benzamidophenyl)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-[1-(3-benzamidophenyl)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 55693559 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[1-(3-benzamidophenyl)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | CC(NC(=O)c1ccc(N2CCCS2(=O)=O)cc1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H25N3O4S/c1-18(21-9-5-10-22(17-21)27-25(30)19-7-3-2-4-8-19)26-24(29)20-11-13-23(14-12-20)28-15-6-16-33(28,31)32/h2-5,7-14,17-18H,6,15-16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | PFPJSTBXEKWVJF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |