C16H18N2O3S2 — CID 18110994
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(1-thiophen-2-ylethyl)benzamide (PubChem CID 18110994) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(1-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(1-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 18110994 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(1-thiophen-2-ylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(N2CCCS2(=O)=O)cc1)c1cccs1 |
| InChI | InChI=1S/C16H18N2O3S2/c1-12(15-4-2-10-22-15)17-16(19)13-5-7-14(8-6-13)18-9-3-11-23(18,20)21/h2,4-8,10,12H,3,9,11H2,1H3,(H,17,19) |
| InChIKey | FMTHIHPZQBRIDL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |