C20H24N2O4S — CID 42333076
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]benzamide (PubChem CID 42333076) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]benzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 42333076 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)c2cccc(N3CCCS3(=O)=O)c2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-3-26-19-10-8-16(9-11-19)15(2)21-20(23)17-6-4-7-18(14-17)22-12-5-13-27(22,24)25/h4,6-11,14-15H,3,5,12-13H2,1-2H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | QQTKJPUYWWGBFG-HNNXBMFYSA-N |
| XLogP | 3.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |