C24H24N2O4S — CID 24596783
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(4-methoxyphenyl)-phenylmethyl]benzamide (PubChem CID 24596783) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(4-methoxyphenyl)-phenylmethyl]benzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(4-methoxyphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 24596783 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[(4-methoxyphenyl)-phenylmethyl]benzamide |
| SMILES | COc1ccc(C(NC(=O)c2cccc(N3CCCS3(=O)=O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-30-22-13-11-19(12-14-22)23(18-7-3-2-4-8-18)25-24(27)20-9-5-10-21(17-20)26-15-6-16-31(26,28)29/h2-5,7-14,17,23H,6,15-16H2,1H3,(H,25,27) |
| InChIKey | CKLMGYBRQDLCIS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |