C24H21NO5S — CID 55486036
(2-oxo-1,2-diphenylethyl) 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 55486036) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 55486036 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | O=C(OC(C(=O)c1ccccc1)c1ccccc1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C24H21NO5S/c26-22(18-9-3-1-4-10-18)23(19-11-5-2-6-12-19)30-24(27)20-13-7-14-21(17-20)25-15-8-16-31(25,28)29/h1-7,9-14,17,23H,8,15-16H2 |
| InChIKey | BHZRXFMIJJMYFN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |