C20H22N4O3 — CID 119440495
3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(ethylaminomethyl)phenyl]benzamide (PubChem CID 119440495) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(ethylaminomethyl)phenyl]benzamide.
| Compound Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(ethylaminomethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 119440495 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(ethylaminomethyl)phenyl]benzamide |
| SMILES | CCNCc1ccccc1NC(=O)c1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C20H22N4O3/c1-2-21-11-16-7-3-4-9-17(16)23-19(26)15-8-5-6-14(10-15)13-24-18(25)12-22-20(24)27/h3-10,21H,2,11-13H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | VDPRSDLNMCUBOL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|