C20H16N4O3 — CID 29331146
3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-quinolin-3-ylbenzamide (PubChem CID 29331146) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-quinolin-3-ylbenzamide.
| Compound Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-quinolin-3-ylbenzamide |
|---|---|
| PubChem CID | 29331146 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-quinolin-3-ylbenzamide |
| SMILES | O=C(Nc1cnc2ccccc2c1)c1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C20H16N4O3/c25-18-11-22-20(27)24(18)12-13-4-3-6-15(8-13)19(26)23-16-9-14-5-1-2-7-17(14)21-10-16/h1-10H,11-12H2,(H,22,27)(H,23,26) |
| InChIKey | BVZLSWCTZXDASJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|