C17H21N3O3 — CID 27670779
N-cyclohexyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 27670779) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-cyclohexyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-cyclohexyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 27670779 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-cyclohexyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C17H21N3O3/c21-15-10-18-17(23)20(15)11-12-6-8-13(9-7-12)16(22)19-14-4-2-1-3-5-14/h6-9,14H,1-5,10-11H2,(H,18,23)(H,19,22) |
| InChIKey | NVAVJQHMJFAYJG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|