C12H20N4O3 — CID 110747875
1-cyclohexyl-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea (PubChem CID 110747875) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 110747875 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-cyclohexyl-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea |
| SMILES | O=C(NCCN1C(=O)CNC1=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H20N4O3/c17-10-8-14-12(19)16(10)7-6-13-11(18)15-9-4-2-1-3-5-9/h9H,1-8H2,(H,14,19)(H2,13,15,18) |
| InChIKey | ZBLGNLCMXPSAIH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|