C14H23N3O — CID 110747697
1-cyclopentyl-3-[2-(2,5-dimethylpyrrol-1-yl)ethyl]urea (PubChem CID 110747697) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(2,5-dimethylpyrrol-1-yl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(2,5-dimethylpyrrol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 110747697 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-cyclopentyl-3-[2-(2,5-dimethylpyrrol-1-yl)ethyl]urea |
| SMILES | Cc1ccc(C)n1CCNC(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H23N3O/c1-11-7-8-12(2)17(11)10-9-15-14(18)16-13-5-3-4-6-13/h7-8,13H,3-6,9-10H2,1-2H3,(H2,15,16,18) |
| InChIKey | FDVCKALMJOXLOA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |