C14H22N4O2 — CID 121121011
1-cyclopentyl-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea (PubChem CID 121121011) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 121121011 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-cyclopentyl-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea |
| SMILES | Cc1ncn(CCNC(=O)NC2CCCC2)c(=O)c1C |
| InChI | InChI=1S/C14H22N4O2/c1-10-11(2)16-9-18(13(10)19)8-7-15-14(20)17-12-5-3-4-6-12/h9,12H,3-8H2,1-2H3,(H2,15,17,20) |
| InChIKey | ZOMJTASSNWUFJY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |