C15H17ClN4O2 — CID 121120963
1-(4-chlorophenyl)-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea (PubChem CID 121120963) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 121120963 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]urea |
| SMILES | Cc1ncn(CCNC(=O)Nc2ccc(Cl)cc2)c(=O)c1C |
| InChI | InChI=1S/C15H17ClN4O2/c1-10-11(2)18-9-20(14(10)21)8-7-17-15(22)19-13-5-3-12(16)4-6-13/h3-6,9H,7-8H2,1-2H3,(H2,17,19,22) |
| InChIKey | KRAWAEPUEDWLEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |