C16H15ClN6O — CID 90589085
1-(4-chlorophenyl)-3-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]urea (PubChem CID 90589085) has the molecular formula C16H15ClN6O and a molecular weight of 342.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 90589085 |
| Molecular Formula | C16H15ClN6O |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]urea |
| SMILES | O=C(NCCn1ccnc1-c1ncccn1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN6O/c17-12-2-4-13(5-3-12)22-16(24)21-9-11-23-10-8-20-15(23)14-18-6-1-7-19-14/h1-8,10H,9,11H2,(H2,21,22,24) |
| InChIKey | NLTLSZNLYYSPNA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |