C19H25N3O2 — CID 121120830
4-tert-butyl-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]benzamide (PubChem CID 121120830) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 121120830 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-tert-butyl-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]benzamide |
| SMILES | Cc1ncn(CCNC(=O)c2ccc(C(C)(C)C)cc2)c(=O)c1C |
| InChI | InChI=1S/C19H25N3O2/c1-13-14(2)21-12-22(18(13)24)11-10-20-17(23)15-6-8-16(9-7-15)19(3,4)5/h6-9,12H,10-11H2,1-5H3,(H,20,23) |
| InChIKey | UNVPERMCDYKDGU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |