C11H20N4O3 — CID 110747884
1-(2,2-dimethylpropyl)-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea (PubChem CID 110747884) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 110747884 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]urea |
| SMILES | CC(C)(C)CNC(=O)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C11H20N4O3/c1-11(2,3)7-14-9(17)12-4-5-15-8(16)6-13-10(15)18/h4-7H2,1-3H3,(H,13,18)(H2,12,14,17) |
| InChIKey | SWVGFICUSYLBJS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|