C13H14ClN3O3 — CID 110719097
2-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]acetamide (PubChem CID 110719097) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110719097 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C13H14ClN3O3/c14-10-3-1-9(2-4-10)7-11(18)15-5-6-17-12(19)8-16-13(17)20/h1-4H,5-8H2,(H,15,18)(H,16,20) |
| InChIKey | JNULWEZLBAIGSP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|