C10H15N3O5 — CID 110719068
methyl 4-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]-4-oxobutanoate (PubChem CID 110719068) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is methyl 4-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 110719068 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | methyl 4-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C10H15N3O5/c1-18-9(16)3-2-7(14)11-4-5-13-8(15)6-12-10(13)17/h2-6H2,1H3,(H,11,14)(H,12,17) |
| InChIKey | DJQUYEPSGBJZKD-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|