C17H23N3O3 — CID 95339120
(2S,3R)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-phenylpentanamide (PubChem CID 95339120) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S,3R)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-phenylpentanamide.
| Compound Name | (2S,3R)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 95339120 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S,3R)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-phenylpentanamide |
| SMILES | CC[C@@H](C)[C@H](C(=O)NCCN1C(=O)CNC1=O)c1ccccc1 |
| InChI | InChI=1S/C17H23N3O3/c1-3-12(2)15(13-7-5-4-6-8-13)16(22)18-9-10-20-14(21)11-19-17(20)23/h4-8,12,15H,3,9-11H2,1-2H3,(H,18,22)(H,19,23)/t12-,15+/m1/s1 |
| InChIKey | HXHRQVMBVNZIDQ-DOMZBBRYSA-N |
| XLogP | 1.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|