C22H37N3O2 — CID 97025367
(2S,3R)-N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl]-3-methyl-2-phenylpentanamide (PubChem CID 97025367) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is (2S,3R)-N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl]-3-methyl-2-phenylpentanamide.
| Compound Name | (2S,3R)-N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl]-3-methyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 97025367 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | (2S,3R)-N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl]-3-methyl-2-phenylpentanamide |
| SMILES | CC[C@@H](C)[C@H](C(=O)NCCCCN1CCN(CCO)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H37N3O2/c1-3-19(2)21(20-9-5-4-6-10-20)22(27)23-11-7-8-12-24-13-15-25(16-14-24)17-18-26/h4-6,9-10,19,21,26H,3,7-8,11-18H2,1-2H3,(H,23,27)/t19-,21+/m1/s1 |
| InChIKey | VKCQPJVBMYPIDZ-CTNGQTDRSA-N |
| XLogP | 2.32 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|