C22H28IN5O2 — CID 109389807
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(2,3-diphenylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 109389807) has the molecular formula C22H28IN5O2 and a molecular weight of 521.40 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(2,3-diphenylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(2,3-diphenylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109389807 |
| Molecular Formula | C22H28IN5O2 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-(2,3-diphenylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1C(=O)CNC1=O)NCC(Cc1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C22H27N5O2.HI/c1-23-21(24-12-13-27-20(28)16-26-22(27)29)25-15-19(18-10-6-3-7-11-18)14-17-8-4-2-5-9-17;/h2-11,19H,12-16H2,1H3,(H,26,29)(H2,23,24,25);1H |
| InChIKey | XAJUXRZKBPDCLW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|