C15H22IN5O3 — CID 111828318
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111828318) has the molecular formula C15H22IN5O3 and a molecular weight of 447.28 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111828318 |
| Molecular Formula | C15H22IN5O3 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1C(=O)CNC1=O)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C15H21N5O3.HI/c1-16-14(17-7-8-20-13(21)10-19-15(20)22)18-9-11-3-5-12(23-2)6-4-11;/h3-6H,7-10H2,1-2H3,(H,19,22)(H2,16,17,18);1H |
| InChIKey | JVZXMLMPQHMMJS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|