C16H24IN5O5 — CID 111827798
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111827798) has the molecular formula C16H24IN5O5 and a molecular weight of 493.30 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111827798 |
| Molecular Formula | C16H24IN5O5 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-methyl-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1C(=O)CNC1=O)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C16H23N5O5.HI/c1-17-15(18-5-6-21-13(22)9-19-16(21)23)20-10-7-11(24-2)14(26-4)12(8-10)25-3;/h7-8H,5-6,9H2,1-4H3,(H,19,23)(H2,17,18,20);1H |
| InChIKey | XOOKADRHQSNMJR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|