C20H33IN4O4 — CID 111827834
N,N-dimethyl-1-[[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide (PubChem CID 111827834) has the molecular formula C20H33IN4O4 and a molecular weight of 520.41 g/mol. Its IUPAC name is N,N-dimethyl-1-[[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide.
| Compound Name | N,N-dimethyl-1-[[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111827834 |
| Molecular Formula | C20H33IN4O4 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N,N-dimethyl-1-[[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCC1(C(=O)N(C)C)CCCC1)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C20H32N4O4.HI/c1-21-19(22-13-20(9-7-8-10-20)18(25)24(2)3)23-14-11-15(26-4)17(28-6)16(12-14)27-5;/h11-12H,7-10,13H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | OYCCWUUIHXTAFS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|